C24H16O — CID 164960653
3,4-bis(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran (PubChem CID 164960653) has the molecular formula C24H16O and a molecular weight of 330.45 g/mol. Its IUPAC name is 3,4-bis(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran.
| Compound Name | 3,4-bis(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran |
|---|---|
| PubChem CID | 164960653 |
| Molecular Formula | C24H16O |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 3,4-bis(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(oc4ccccc43)c2-c2c([2H])c([2H])c([2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C24H16O/c1-3-9-17(10-4-1)19-15-16-21-20-13-7-8-14-22(20)25-24(21)23(19)18-11-5-2-6-12-18/h1-16H/i1D,2D,3D,4D,5D,6D,9D,10D,11D,12D |
| InChIKey | WUEZAFKHWNCRFL-CRDOFXDFSA-N |
| XLogP | 6.92 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |