C19H14O2 — CID 165032296
3-methoxy-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran (PubChem CID 165032296) has the molecular formula C19H14O2 and a molecular weight of 279.35 g/mol. Its IUPAC name is 3-methoxy-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran.
| Compound Name | 3-methoxy-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran |
|---|---|
| PubChem CID | 165032296 |
| Molecular Formula | C19H14O2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-methoxy-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c(OC)ccc3c2oc2ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C19H14O2/c1-20-17-12-11-15-14-9-5-6-10-16(14)21-19(15)18(17)13-7-3-2-4-8-13/h2-12H,1H3/i2D,3D,4D,7D,8D |
| InChIKey | OPQCIVKQHDAFRQ-ATTUOBAHSA-N |
| XLogP | 5.26 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |