C29H19BrO — CID 164970165
9-bromo-7-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzo[a]phenalen-7-ol (PubChem CID 164970165) has the molecular formula C29H19BrO and a molecular weight of 468.40 g/mol. Its IUPAC name is 9-bromo-7-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzo[a]phenalen-7-ol.
| Compound Name | 9-bromo-7-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzo[a]phenalen-7-ol |
|---|---|
| PubChem CID | 164970165 |
| Molecular Formula | C29H19BrO |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 9-bromo-7-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzo[a]phenalen-7-ol |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccccc2C2(O)c3cc(Br)ccc3-c3cccc4cccc2c34)c([2H])c1[2H] |
| InChI | InChI=1S/C29H19BrO/c30-21-16-17-23-24-13-6-10-20-11-7-15-26(28(20)24)29(31,27(23)18-21)25-14-5-4-12-22(25)19-8-2-1-3-9-19/h1-18,31H/i1D,2D,3D,8D,9D |
| InChIKey | MQFDSZNTWKAIKD-NWCULCSXSA-N |
| XLogP | 7.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |