C24H28Cl2N6O2 — CID 164981703
(2-chloro-3-pyridinyl)-(3-ethyl-1-methylpyrazol-5-yl)methanol (PubChem CID 164981703) has the molecular formula C24H28Cl2N6O2 and a molecular weight of 503.43 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)-(3-ethyl-1-methylpyrazol-5-yl)methanol.
| Compound Name | (2-chloro-3-pyridinyl)-(3-ethyl-1-methylpyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 164981703 |
| Molecular Formula | C24H28Cl2N6O2 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | (2-chloro-3-pyridinyl)-(3-ethyl-1-methylpyrazol-5-yl)methanol |
| SMILES | CCc1cc(C(O)c2cccnc2Cl)n(C)n1.CCc1cc(C(O)c2cccnc2Cl)n(C)n1 |
| InChI | InChI=1S/2C12H14ClN3O/c2*1-3-8-7-10(16(2)15-8)11(17)9-5-4-6-14-12(9)13/h2*4-7,11,17H,3H2,1-2H3 |
| InChIKey | FOXBPAACSNUQIY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|