About 5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole
5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole (PubChem CID 165006333) has the molecular formula C16H13F2NO2S
and a molecular weight of 321.35 g/mol. Its IUPAC name is 5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole.
Molecular Properties
| Compound Name | 5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole |
| PubChem CID | 165006333 |
| Molecular Formula | C16H13F2NO2S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole |
| SMILES | C=C1Cc2cc(CS(=O)(=O)c3ccc(F)cc3F)ccc2N1 |
| InChI | InChI=1S/C16H13F2NO2S/c1-10-6-12-7-11(2-4-15(12)19-10)9-22(20,21)16-5-3-13(17)8-14(16)18/h2-5,7-8,19H,1,6,9H2 |
| InChIKey | ZZJPQHMIWMMBTC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole?
The IUPAC name of 5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole (CID 165006333) is 5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole.
What is the SMILES notation for 5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole?
The canonical SMILES for 5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole is C=C1Cc2cc(CS(=O)(=O)c3ccc(F)cc3F)ccc2N1.
What is the InChIKey of 5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole?
The InChIKey is ZZJPQHMIWMMBTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F2NO2S/c1-10-6-12-7-11(2-4-15(12)19-10)9-22(20,21)16-5-3-13(17)8-14(16)18/h2-5,7-8,19H,1,6,9H2.
What are the key properties of 5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole?
5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole has a molecular weight of 321.35 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4-difluorophenyl)sulfonylmethyl]-2-methylidene-1,3-dihydroindole is sourced from PubChem (CID 165006333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).