C26H30N4O4 — CID 165011080
tert-butyl 2-[5-[[2-[(2R,4S)-4-cyano-2-phenylpiperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]acetate (PubChem CID 165011080) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is tert-butyl 2-[5-[[2-[(2R,4S)-4-cyano-2-phenylpiperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]acetate.
| Compound Name | tert-butyl 2-[5-[[2-[(2R,4S)-4-cyano-2-phenylpiperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 165011080 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | tert-butyl 2-[5-[[2-[(2R,4S)-4-cyano-2-phenylpiperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]acetate |
| SMILES | Cc1cc(NC(=O)C(=O)N2CC[C@H](C#N)C[C@@H]2c2ccccc2)cnc1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H30N4O4/c1-17-12-20(16-28-21(17)14-23(31)34-26(2,3)4)29-24(32)25(33)30-11-10-18(15-27)13-22(30)19-8-6-5-7-9-19/h5-9,12,16,18,22H,10-11,13-14H2,1-4H3,(H,29,32)/t18-,22+/m0/s1 |
| InChIKey | HOXQWOOZSPCGMQ-PGRDOPGGSA-N |
| XLogP | 3.72 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|