C53H73B10N4O14P3S — CID 165011823
CID 165011823 (PubChem CID 165011823) has the molecular formula C53H73B10N4O14P3S and a molecular weight of 1223.29 g/mol.
| Compound Name | CID 165011823 |
|---|---|
| PubChem CID | 165011823 |
| Molecular Formula | C53H73B10N4O14P3S |
| Molecular Weight | 1223.29 g/mol |
| Exact Mass | 1224.50 |
| IUPAC Name | — |
| SMILES | [B]B=S(=B[B])(CC(=O)CCC(NC(=O)CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C)C(=O)NCCOCCOCC(=O)CC(CCC(=O)CP([B])C)C(=O)NC(CCC(=O)CP([B])C)C(=O)CP([B])C)B([B])[B] |
| InChI | InChI=1S/C53H73B10N4O14P3S/c1-53(2,3)81-51(76)46(67-52(77)80-29-43-41-13-9-7-11-39(41)40-12-8-10-14-42(40)43)21-22-48(73)65-45(20-18-37(70)33-85(61-54,62-55)63(56)57)50(75)64-23-24-78-25-26-79-28-38(71)27-34(15-16-35(68)30-82(4)58)49(74)66-44(47(72)32-84(6)60)19-17-36(69)31-83(5)59/h7-14,34,43-46H,15-33H2,1-6H3,(H,64,75)(H,65,73)(H,66,74)(H,67,77) |
| InChIKey | BFSFAWPOIBHAKU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 255.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1223.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|