C44H73B10N4O14P3S — CID 165082892
CID 165082892 (PubChem CID 165082892) has the molecular formula C44H73B10N4O14P3S and a molecular weight of 1115.19 g/mol.
| Compound Name | CID 165082892 |
|---|---|
| PubChem CID | 165082892 |
| Molecular Formula | C44H73B10N4O14P3S |
| Molecular Weight | 1115.19 g/mol |
| Exact Mass | 1116.50 |
| IUPAC Name | — |
| SMILES | [B]B=S(=B[B])(CC(=O)CCC(NC(=O)CCC(NCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)NCCOCCOCC(=O)CC(CCC(=O)CP([B])C)C(=O)NC(CCC(=O)CP([B])C)C(=O)CP([B])C)B([B])[B] |
| InChI | InChI=1S/C44H73B10N4O14P3S/c1-43(2,3)71-39(65)23-56-36(42(68)72-44(4,5)6)16-17-38(64)57-35(15-13-32(61)28-76(52-45,53-46)54(47)48)41(67)55-18-19-69-20-21-70-24-33(62)22-29(10-11-30(59)25-73(7)49)40(66)58-34(37(63)27-75(9)51)14-12-31(60)26-74(8)50/h29,34-36,56H,10-28H2,1-9H3,(H,55,67)(H,57,64)(H,58,66) |
| InChIKey | KSXHUBOZOBUWHS-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 255.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1115.19 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|