C16H27N3O7S — CID 165014456
2-amino-8-(carboxymethylamino)-7-(diethylcarbamoylsulfanylmethyl)-5,8-dioxooctanoic acid (PubChem CID 165014456) has the molecular formula C16H27N3O7S and a molecular weight of 405.47 g/mol. Its IUPAC name is 2-amino-8-(carboxymethylamino)-7-(diethylcarbamoylsulfanylmethyl)-5,8-dioxooctanoic acid.
| Compound Name | 2-amino-8-(carboxymethylamino)-7-(diethylcarbamoylsulfanylmethyl)-5,8-dioxooctanoic acid |
|---|---|
| PubChem CID | 165014456 |
| Molecular Formula | C16H27N3O7S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-amino-8-(carboxymethylamino)-7-(diethylcarbamoylsulfanylmethyl)-5,8-dioxooctanoic acid |
| SMILES | CCN(CC)C(=O)SCC(CC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C16H27N3O7S/c1-3-19(4-2)16(26)27-9-10(14(23)18-8-13(21)22)7-11(20)5-6-12(17)15(24)25/h10,12H,3-9,17H2,1-2H3,(H,18,23)(H,21,22)(H,24,25) |
| InChIKey | KEZOZTVHLFQGGZ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|