C19H20N6O3S — CID 165015884
4-(2-hydroxyethoxy)-1-[1-methyl-2-([1,3]thiazolo[4,5-b]pyrazin-2-ylamino)benzimidazol-5-yl]butan-1-one (PubChem CID 165015884) has the molecular formula C19H20N6O3S and a molecular weight of 412.48 g/mol. Its IUPAC name is 4-(2-hydroxyethoxy)-1-[1-methyl-2-([1,3]thiazolo[4,5-b]pyrazin-2-ylamino)benzimidazol-5-yl]butan-1-one.
| Compound Name | 4-(2-hydroxyethoxy)-1-[1-methyl-2-([1,3]thiazolo[4,5-b]pyrazin-2-ylamino)benzimidazol-5-yl]butan-1-one |
|---|---|
| PubChem CID | 165015884 |
| Molecular Formula | C19H20N6O3S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-(2-hydroxyethoxy)-1-[1-methyl-2-([1,3]thiazolo[4,5-b]pyrazin-2-ylamino)benzimidazol-5-yl]butan-1-one |
| SMILES | Cn1c(Nc2nc3nccnc3s2)nc2cc(C(=O)CCCOCCO)ccc21 |
| InChI | InChI=1S/C19H20N6O3S/c1-25-14-5-4-12(15(27)3-2-9-28-10-8-26)11-13(14)22-18(25)24-19-23-16-17(29-19)21-7-6-20-16/h4-7,11,26H,2-3,8-10H2,1H3,(H,20,22,23,24) |
| InChIKey | AIHPPFHPFLHWPJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|