C43H50BN2O9P — CID 165016358
CID 165016358 (PubChem CID 165016358) has the molecular formula C43H50BN2O9P and a molecular weight of 780.66 g/mol.
| Compound Name | CID 165016358 |
|---|---|
| PubChem CID | 165016358 |
| Molecular Formula | C43H50BN2O9P |
| Molecular Weight | 780.66 g/mol |
| Exact Mass | 780.33 |
| IUPAC Name | — |
| SMILES | [B]P(C)C(=O)CNC(=O)C(CC(=O)C(Cc1ccccc1)NC(=O)CCC(=O)CCC(CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)CC(C)C |
| InChI | InChI=1S/C43H50BN2O9P/c1-27(2)21-30(42(52)45-25-41(51)56(3)44)23-38(48)37(22-28-11-5-4-6-12-28)46-39(49)20-19-31(47)18-17-29(43(53)54)24-40(50)55-26-36-34-15-9-7-13-32(34)33-14-8-10-16-35(33)36/h4-16,27,29-30,36-37H,17-26H2,1-3H3,(H,45,52)(H,46,49)(H,53,54) |
| InChIKey | AVSRCSIPOKUMJG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 173.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.66 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|