C30H38ClN5O6 — CID 165019016
tert-butyl (2S)-2-[4-(2-amino-5-chlorophenyl)-2,3-dioxopiperazin-1-yl]-3-[4-[4-(2-methoxyethyl)-2-oxopiperazin-1-yl]phenyl]propanoate (PubChem CID 165019016) has the molecular formula C30H38ClN5O6 and a molecular weight of 600.12 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-(2-amino-5-chlorophenyl)-2,3-dioxopiperazin-1-yl]-3-[4-[4-(2-methoxyethyl)-2-oxopiperazin-1-yl]phenyl]propanoate.
| Compound Name | tert-butyl (2S)-2-[4-(2-amino-5-chlorophenyl)-2,3-dioxopiperazin-1-yl]-3-[4-[4-(2-methoxyethyl)-2-oxopiperazin-1-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 165019016 |
| Molecular Formula | C30H38ClN5O6 |
| Molecular Weight | 600.12 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | tert-butyl (2S)-2-[4-(2-amino-5-chlorophenyl)-2,3-dioxopiperazin-1-yl]-3-[4-[4-(2-methoxyethyl)-2-oxopiperazin-1-yl]phenyl]propanoate |
| SMILES | COCCN1CCN(c2ccc(C[C@@H](C(=O)OC(C)(C)C)N3CCN(c4cc(Cl)ccc4N)C(=O)C3=O)cc2)C(=O)C1 |
| InChI | InChI=1S/C30H38ClN5O6/c1-30(2,3)42-29(40)25(36-14-13-35(27(38)28(36)39)24-18-21(31)7-10-23(24)32)17-20-5-8-22(9-6-20)34-12-11-33(15-16-41-4)19-26(34)37/h5-10,18,25H,11-17,19,32H2,1-4H3/t25-/m0/s1 |
| InChIKey | KWHZHJPWXDCENS-VWLOTQADSA-N |
| XLogP | 2.35 |
| TPSA | 125.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.12 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|