C34H40ClN5O6 — CID 175282088
2-[4-[2-[bis(prop-2-enyl)amino]-5-chlorophenyl]-2,3-dioxopiperazin-1-yl]-3-[4-[4-(oxan-4-yl)-2-oxopiperazin-1-yl]phenyl]propanoic acid (PubChem CID 175282088) has the molecular formula C34H40ClN5O6 and a molecular weight of 650.18 g/mol. Its IUPAC name is 2-[4-[2-[bis(prop-2-enyl)amino]-5-chlorophenyl]-2,3-dioxopiperazin-1-yl]-3-[4-[4-(oxan-4-yl)-2-oxopiperazin-1-yl]phenyl]propanoic acid.
| Compound Name | 2-[4-[2-[bis(prop-2-enyl)amino]-5-chlorophenyl]-2,3-dioxopiperazin-1-yl]-3-[4-[4-(oxan-4-yl)-2-oxopiperazin-1-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 175282088 |
| Molecular Formula | C34H40ClN5O6 |
| Molecular Weight | 650.18 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | 2-[4-[2-[bis(prop-2-enyl)amino]-5-chlorophenyl]-2,3-dioxopiperazin-1-yl]-3-[4-[4-(oxan-4-yl)-2-oxopiperazin-1-yl]phenyl]propanoic acid |
| SMILES | C=CCN(CC=C)c1ccc(Cl)cc1N1CCN(C(Cc2ccc(N3CCN(C4CCOCC4)CC3=O)cc2)C(=O)O)C(=O)C1=O |
| InChI | InChI=1S/C34H40ClN5O6/c1-3-13-36(14-4-2)28-10-7-25(35)22-29(28)39-17-18-40(33(43)32(39)42)30(34(44)45)21-24-5-8-27(9-6-24)38-16-15-37(23-31(38)41)26-11-19-46-20-12-26/h3-10,22,26,30H,1-2,11-21,23H2,(H,44,45) |
| InChIKey | FNHOYMAVBBQNLN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.18 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|