C24H33ClN4O6 — CID 16502047
[2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] 4-(4-chloro-3-methylphenoxy)butanoate (PubChem CID 16502047) has the molecular formula C24H33ClN4O6 and a molecular weight of 509.00 g/mol. Its IUPAC name is [2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] 4-(4-chloro-3-methylphenoxy)butanoate.
| Compound Name | [2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] 4-(4-chloro-3-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 16502047 |
| Molecular Formula | C24H33ClN4O6 |
| Molecular Weight | 509.00 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | [2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] 4-(4-chloro-3-methylphenoxy)butanoate |
| SMILES | CCCCN(C(=O)COC(=O)CCCOc1ccc(Cl)c(C)c1)c1c(N)n(CCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H33ClN4O6/c1-4-6-12-28(21-22(26)29(11-5-2)24(33)27-23(21)32)19(30)15-35-20(31)8-7-13-34-17-9-10-18(25)16(3)14-17/h9-10,14H,4-8,11-13,15,26H2,1-3H3,(H,27,32,33) |
| InChIKey | HCENPEDNATXOOE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 136.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.00 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|