C60H72N18O9 — CID 165027139
(11R)-4-methoxy-10,11-dimethyl-18-(methylamino)-9-oxa-2,12,16,17,20-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3,5,7(22),14(21),15,18-heptaen-13-one (PubChem CID 165027139) has the molecular formula C60H72N18O9 and a molecular weight of 1189.35 g/mol. Its IUPAC name is (11R)-4-methoxy-10,11-dimethyl-18-(methylamino)-9-oxa-2,12,16,17,20-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3,5,7(22),14(21),15,18-heptaen-13-one.
| Compound Name | (11R)-4-methoxy-10,11-dimethyl-18-(methylamino)-9-oxa-2,12,16,17,20-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3,5,7(22),14(21),15,18-heptaen-13-one |
|---|---|
| PubChem CID | 165027139 |
| Molecular Formula | C60H72N18O9 |
| Molecular Weight | 1189.35 g/mol |
| Exact Mass | 1188.57 |
| IUPAC Name | (11R)-4-methoxy-10,11-dimethyl-18-(methylamino)-9-oxa-2,12,16,17,20-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3,5,7(22),14(21),15,18-heptaen-13-one |
| SMILES | CNc1cc2nc3c(cnn13)C(=O)N[C@H](C)C(C)OCc1ccc(OC)c(c1)N2.CNc1cc2nc3c(cnn13)C(=O)N[C@H](C)C(C)OCc1ccc(OC)c(c1)N2.CNc1cc2nc3c(cnn13)C(=O)N[C@H](C)C(C)OCc1ccc(OC)c(c1)N2 |
| InChI | InChI=1S/3C20H24N6O3/c3*1-11-12(2)29-10-13-5-6-16(28-4)15(7-13)24-17-8-18(21-3)26-19(25-17)14(9-22-26)20(27)23-11/h3*5-9,11-12,21H,10H2,1-4H3,(H,23,27)(H,24,25)/t3*11-,12?/m111/s1 |
| InChIKey | MBMVVEDQWKQROE-AFUMOMSISA-N |
| XLogP | 7.68 |
| TPSA | 305.43 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 87 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1189.35 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 24 |