C20H27N9O3 — CID 169191490
4-amino-5-[amino(methyl)amino]-12-(hydroxymethyl)-19-(methylamino)-9-oxa-2,13,17,18,21-pentazatetracyclo[13.5.2.13,7.018,22]tricosa-1(21),3,5,7(23),15(22),16,19-heptaen-14-one (PubChem CID 169191490) has the molecular formula C20H27N9O3 and a molecular weight of 441.50 g/mol. Its IUPAC name is 4-amino-5-[amino(methyl)amino]-12-(hydroxymethyl)-19-(methylamino)-9-oxa-2,13,17,18,21-pentazatetracyclo[13.5.2.13,7.018,22]tricosa-1(21),3,5,7(23),15(22),16,19-heptaen-14-one.
| Compound Name | 4-amino-5-[amino(methyl)amino]-12-(hydroxymethyl)-19-(methylamino)-9-oxa-2,13,17,18,21-pentazatetracyclo[13.5.2.13,7.018,22]tricosa-1(21),3,5,7(23),15(22),16,19-heptaen-14-one |
|---|---|
| PubChem CID | 169191490 |
| Molecular Formula | C20H27N9O3 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 4-amino-5-[amino(methyl)amino]-12-(hydroxymethyl)-19-(methylamino)-9-oxa-2,13,17,18,21-pentazatetracyclo[13.5.2.13,7.018,22]tricosa-1(21),3,5,7(23),15(22),16,19-heptaen-14-one |
| SMILES | CNc1cc2nc3c(cnn13)C(=O)NC(CO)CCOCc1cc(c(N)c(N(C)N)c1)N2 |
| InChI | InChI=1S/C20H27N9O3/c1-23-17-7-16-26-14-5-11(6-15(18(14)21)28(2)22)10-32-4-3-12(9-30)25-20(31)13-8-24-29(17)19(13)27-16/h5-8,12,23,30H,3-4,9-10,21-22H2,1-2H3,(H,25,31)(H,26,27) |
| InChIKey | KGAPEMPMQQLSJK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 168.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|