C20H27N9O2 — CID 169191529
5-amino-4-[amino(methyl)amino]-10,11-dimethyl-18-(methylamino)-9-oxa-2,12,16,17,20-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3(22),4,6,14(21),15,18-heptaen-13-one (PubChem CID 169191529) has the molecular formula C20H27N9O2 and a molecular weight of 425.50 g/mol. Its IUPAC name is 5-amino-4-[amino(methyl)amino]-10,11-dimethyl-18-(methylamino)-9-oxa-2,12,16,17,20-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3(22),4,6,14(21),15,18-heptaen-13-one.
| Compound Name | 5-amino-4-[amino(methyl)amino]-10,11-dimethyl-18-(methylamino)-9-oxa-2,12,16,17,20-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3(22),4,6,14(21),15,18-heptaen-13-one |
|---|---|
| PubChem CID | 169191529 |
| Molecular Formula | C20H27N9O2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 5-amino-4-[amino(methyl)amino]-10,11-dimethyl-18-(methylamino)-9-oxa-2,12,16,17,20-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3(22),4,6,14(21),15,18-heptaen-13-one |
| SMILES | CNc1cc2nc3c(cnn13)C(=O)NC(C)C(C)OCc1cc(N)c(N(C)N)c(c1)N2 |
| InChI | InChI=1S/C20H27N9O2/c1-10-11(2)31-9-12-5-14(21)18(28(4)22)15(6-12)26-16-7-17(23-3)29-19(27-16)13(8-24-29)20(30)25-10/h5-8,10-11,23H,9,21-22H2,1-4H3,(H,25,30)(H,26,27) |
| InChIKey | QVKIVHLHMLKQAA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 147.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|