C34H34BBrN4O8 — CID 165028562
ethyl 5-(3-bromopyrazolo[1,5-a]pyridin-5-yl)furan-3-carboxylate;ethyl 5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridin-5-yl]furan-3-carboxylate (PubChem CID 165028562) has the molecular formula C34H34BBrN4O8 and a molecular weight of 717.38 g/mol. Its IUPAC name is ethyl 5-(3-bromopyrazolo[1,5-a]pyridin-5-yl)furan-3-carboxylate;ethyl 5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridin-5-yl]furan-3-carboxylate.
| Compound Name | ethyl 5-(3-bromopyrazolo[1,5-a]pyridin-5-yl)furan-3-carboxylate;ethyl 5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridin-5-yl]furan-3-carboxylate |
|---|---|
| PubChem CID | 165028562 |
| Molecular Formula | C34H34BBrN4O8 |
| Molecular Weight | 717.38 g/mol |
| Exact Mass | 716.17 |
| IUPAC Name | ethyl 5-(3-bromopyrazolo[1,5-a]pyridin-5-yl)furan-3-carboxylate;ethyl 5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridin-5-yl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1coc(-c2ccn3ncc(B4OC(C)(C)C(C)(C)O4)c3c2)c1.CCOC(=O)c1coc(-c2ccn3ncc(Br)c3c2)c1 |
| InChI | InChI=1S/C20H23BN2O5.C14H11BrN2O3/c1-6-25-18(24)14-10-17(26-12-14)13-7-8-23-16(9-13)15(11-22-23)21-27-19(2,3)20(4,5)28-21;1-2-19-14(18)10-6-13(20-8-10)9-3-4-17-12(5-9)11(15)7-16-17/h7-12H,6H2,1-5H3;3-8H,2H2,1H3 |
| InChIKey | MGWQVQYMEVQCGD-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 131.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.38 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|