C22H27B3BrN4O2P — CID 167538775
CID 167538775 (PubChem CID 167538775) has the molecular formula C22H27B3BrN4O2P and a molecular weight of 522.80 g/mol.
| Compound Name | CID 167538775 |
|---|---|
| PubChem CID | 167538775 |
| Molecular Formula | C22H27B3BrN4O2P |
| Molecular Weight | 522.80 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(B3OC(C)(C)C(C)(C)O3)cnn2c1.Cc1ccc2c(Br)cnn2c1.[B]P[B] |
| InChI | InChI=1S/C14H19BN2O2.C8H7BrN2.B2HP/c1-10-6-7-12-11(8-16-17(12)9-10)15-18-13(2,3)14(4,5)19-15;1-6-2-3-8-7(9)4-10-11(8)5-6;1-3-2/h6-9H,1-5H3;2-5H,1H3;3H |
| InChIKey | VUEBHAWWRVMGNS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 53.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.80 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|