C42H58N6O15 — CID 165031246
(2R)-2-[[4-[5-(2,5-dioxopyrrol-1-yl)-2-oxopentoxy]phenyl]methyl]-4-oxo-5-[[6-oxo-7-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]heptanoyl]amino]pentanoic acid (PubChem CID 165031246) has the molecular formula C42H58N6O15 and a molecular weight of 886.95 g/mol. Its IUPAC name is (2R)-2-[[4-[5-(2,5-dioxopyrrol-1-yl)-2-oxopentoxy]phenyl]methyl]-4-oxo-5-[[6-oxo-7-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]heptanoyl]amino]pentanoic acid.
| Compound Name | (2R)-2-[[4-[5-(2,5-dioxopyrrol-1-yl)-2-oxopentoxy]phenyl]methyl]-4-oxo-5-[[6-oxo-7-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]heptanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 165031246 |
| Molecular Formula | C42H58N6O15 |
| Molecular Weight | 886.95 g/mol |
| Exact Mass | 886.40 |
| IUPAC Name | (2R)-2-[[4-[5-(2,5-dioxopyrrol-1-yl)-2-oxopentoxy]phenyl]methyl]-4-oxo-5-[[6-oxo-7-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]heptanoyl]amino]pentanoic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)CCCCC(=O)NCC(=O)C[C@@H](Cc2ccc(OCC(=O)CCCN3C(=O)C=CC3=O)cc2)C(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C42H58N6O15/c49-32(25-44-14-16-45(26-39(55)56)18-20-47(28-41(59)60)21-19-46(17-15-44)27-40(57)58)4-1-2-6-36(52)43-24-34(51)23-31(42(61)62)22-30-7-9-35(10-8-30)63-29-33(50)5-3-13-48-37(53)11-12-38(48)54/h7-12,31H,1-6,13-29H2,(H,43,52)(H,55,56)(H,57,58)(H,59,60)(H,61,62)/t31-/m1/s1 |
| InChIKey | HJHDLTBRVCWWBR-WJOKGBTCSA-N |
| XLogP | -0.74 |
| TPSA | 289.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.95 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|