C29H41BrN6O4 — CID 165035293
1-[3-[[(2R,3S,4R,5R)-5-(5-bromo-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(4-tert-butylphenyl)urea (PubChem CID 165035293) has the molecular formula C29H41BrN6O4 and a molecular weight of 617.59 g/mol. Its IUPAC name is 1-[3-[[(2R,3S,4R,5R)-5-(5-bromo-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-[[(2R,3S,4R,5R)-5-(5-bromo-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 165035293 |
| Molecular Formula | C29H41BrN6O4 |
| Molecular Weight | 617.59 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | 1-[3-[[(2R,3S,4R,5R)-5-(5-bromo-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(4-tert-butylphenyl)urea |
| SMILES | Cc1ncnc2c1c(Br)cn2[C@@H]1O[C@H](CN(CCCNC(=O)Nc2ccc(C(C)(C)C)cc2)C(C)C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C29H41BrN6O4/c1-17(2)35(13-7-12-31-28(39)34-20-10-8-19(9-11-20)29(4,5)6)15-22-24(37)25(38)27(40-22)36-14-21(30)23-18(3)32-16-33-26(23)36/h8-11,14,16-17,22,24-25,27,37-38H,7,12-13,15H2,1-6H3,(H2,31,34,39)/t22-,24-,25-,27-/m1/s1 |
| InChIKey | NHEKKTSNTRXVFV-LYPBTDJXSA-N |
| XLogP | 4.34 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|