C57H45N3Si2 — CID 165063137
cyclohexa-1,5-dien-1-yl-diphenyl-[3-[4-phenyl-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]silane (PubChem CID 165063137) has the molecular formula C57H45N3Si2 and a molecular weight of 828.18 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-yl-diphenyl-[3-[4-phenyl-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]silane.
| Compound Name | cyclohexa-1,5-dien-1-yl-diphenyl-[3-[4-phenyl-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]silane |
|---|---|
| PubChem CID | 165063137 |
| Molecular Formula | C57H45N3Si2 |
| Molecular Weight | 828.18 g/mol |
| Exact Mass | 827.32 |
| IUPAC Name | cyclohexa-1,5-dien-1-yl-diphenyl-[3-[4-phenyl-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]silane |
| SMILES | C1=CC([Si](c2ccccc2)(c2ccccc2)c2cccc(-c3nc(-c4ccccc4)nc(-c4cccc([Si](c5ccccc5)(c5ccccc5)c5ccccc5)c4)n3)c2)=CCC1 |
| InChI | InChI=1S/C57H45N3Si2/c1-8-24-44(25-9-1)55-58-56(45-26-22-40-53(42-45)61(47-28-10-2-11-29-47,48-30-12-3-13-31-48)49-32-14-4-15-33-49)60-57(59-55)46-27-23-41-54(43-46)62(50-34-16-5-17-35-50,51-36-18-6-19-37-51)52-38-20-7-21-39-52/h1-6,8-20,22-43H,7,21H2 |
| InChIKey | RNOVYAXHOYMIGE-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.18 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|