About 4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide
4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide (PubChem CID 165064656) has the molecular formula C20H19N3O2S
and a molecular weight of 365.46 g/mol. Its IUPAC name is 4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide |
| PubChem CID | 165064656 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc2c(c1)ncc1cc(C)n(Cc3ccc(S(N)(=O)=O)cc3)c12 |
| InChI | InChI=1S/C20H19N3O2S/c1-13-3-8-18-19(9-13)22-11-16-10-14(2)23(20(16)18)12-15-4-6-17(7-5-15)26(21,24)25/h3-11H,12H2,1-2H3,(H2,21,24,25) |
| InChIKey | NFPQYVFSUYWTPJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide?
The IUPAC name of 4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide (CID 165064656) is 4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide.
What is the SMILES notation for 4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide?
The canonical SMILES for 4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide is Cc1ccc2c(c1)ncc1cc(C)n(Cc3ccc(S(N)(=O)=O)cc3)c12.
What is the InChIKey of 4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide?
The InChIKey is NFPQYVFSUYWTPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O2S/c1-13-3-8-18-19(9-13)22-11-16-10-14(2)23(20(16)18)12-15-4-6-17(7-5-15)26(21,24)25/h3-11H,12H2,1-2H3,(H2,21,24,25).
What are the key properties of 4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide?
4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide has a molecular weight of 365.46 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,7-dimethylpyrrolo[3,2-c]quinolin-1-yl)methyl]benzenesulfonamide is sourced from PubChem (CID 165064656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).