C11H6N2O2 — CID 165077456
pyrrolo[3,4-c]isoquinoline-1,3-dione (PubChem CID 165077456) has the molecular formula C11H6N2O2 and a molecular weight of 198.18 g/mol. Its IUPAC name is pyrrolo[3,4-c]isoquinoline-1,3-dione.
| Compound Name | pyrrolo[3,4-c]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 165077456 |
| Molecular Formula | C11H6N2O2 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | pyrrolo[3,4-c]isoquinoline-1,3-dione |
| SMILES | O=C1NC(=O)c2c1ncc1ccccc21 |
| InChI | InChI=1S/C11H6N2O2/c14-10-8-7-4-2-1-3-6(7)5-12-9(8)11(15)13-10/h1-5H,(H,13,14,15) |
| InChIKey | UNZQBOHRFJQWAE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|