C15H12BrNO2 — CID 67876975
4-(3-bromopropyl)benzo[e]isoindole-1,3-dione (PubChem CID 67876975) has the molecular formula C15H12BrNO2 and a molecular weight of 318.17 g/mol. Its IUPAC name is 4-(3-bromopropyl)benzo[e]isoindole-1,3-dione.
| Compound Name | 4-(3-bromopropyl)benzo[e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67876975 |
| Molecular Formula | C15H12BrNO2 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 4-(3-bromopropyl)benzo[e]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c1c(CCCBr)cc1ccccc21 |
| InChI | InChI=1S/C15H12BrNO2/c16-7-3-5-10-8-9-4-1-2-6-11(9)13-12(10)14(18)17-15(13)19/h1-2,4,6,8H,3,5,7H2,(H,17,18,19) |
| InChIKey | NWQVDXINWKWLDK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|