C17H20F6N4O3S — CID 165078682
1,1,1,3,3,3-hexafluoropropan-2-yl (2S)-2-[(6-methylpyridazin-3-yl)carbamoyl]-6-azaspiro[2.5]octane-6-carboxylate;sulfane (PubChem CID 165078682) has the molecular formula C17H20F6N4O3S and a molecular weight of 474.43 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (2S)-2-[(6-methylpyridazin-3-yl)carbamoyl]-6-azaspiro[2.5]octane-6-carboxylate;sulfane.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (2S)-2-[(6-methylpyridazin-3-yl)carbamoyl]-6-azaspiro[2.5]octane-6-carboxylate;sulfane |
|---|---|
| PubChem CID | 165078682 |
| Molecular Formula | C17H20F6N4O3S |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (2S)-2-[(6-methylpyridazin-3-yl)carbamoyl]-6-azaspiro[2.5]octane-6-carboxylate;sulfane |
| SMILES | Cc1ccc(NC(=O)[C@H]2CC23CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC3)nn1.S |
| InChI | InChI=1S/C17H18F6N4O3.H2S/c1-9-2-3-11(26-25-9)24-12(28)10-8-15(10)4-6-27(7-5-15)14(29)30-13(16(18,19)20)17(21,22)23;/h2-3,10,13H,4-8H2,1H3,(H,24,26,28);1H2/t10-;/m1./s1 |
| InChIKey | UTGFPZQWTACJES-HNCPQSOCSA-N |
| XLogP | 3.57 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |