C23H18FNO4S2 — CID 165089930
methyl 5-[2-fluoro-5-(1-phenylethylsulfanyl)phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylate (PubChem CID 165089930) has the molecular formula C23H18FNO4S2 and a molecular weight of 455.53 g/mol. Its IUPAC name is methyl 5-[2-fluoro-5-(1-phenylethylsulfanyl)phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylate.
| Compound Name | methyl 5-[2-fluoro-5-(1-phenylethylsulfanyl)phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 165089930 |
| Molecular Formula | C23H18FNO4S2 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | methyl 5-[2-fluoro-5-(1-phenylethylsulfanyl)phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylate |
| SMILES | COC(=O)c1scc2c1C(=O)N(c1cc(SC(C)c3ccccc3)ccc1F)C(=O)C2 |
| InChI | InChI=1S/C23H18FNO4S2/c1-13(14-6-4-3-5-7-14)31-16-8-9-17(24)18(11-16)25-19(26)10-15-12-30-21(23(28)29-2)20(15)22(25)27/h3-9,11-13H,10H2,1-2H3 |
| InChIKey | WNHGDMDWUKHZNC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|