C24H18FNO4S2 — CID 164985188
5-[2-fluoro-5-(1-phenylcyclobutyl)sulfanylphenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid (PubChem CID 164985188) has the molecular formula C24H18FNO4S2 and a molecular weight of 467.54 g/mol. Its IUPAC name is 5-[2-fluoro-5-(1-phenylcyclobutyl)sulfanylphenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid.
| Compound Name | 5-[2-fluoro-5-(1-phenylcyclobutyl)sulfanylphenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 164985188 |
| Molecular Formula | C24H18FNO4S2 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 5-[2-fluoro-5-(1-phenylcyclobutyl)sulfanylphenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1scc2c1C(=O)N(c1cc(SC3(c4ccccc4)CCC3)ccc1F)C(=O)C2 |
| InChI | InChI=1S/C24H18FNO4S2/c25-17-8-7-16(32-24(9-4-10-24)15-5-2-1-3-6-15)12-18(17)26-19(27)11-14-13-31-21(23(29)30)20(14)22(26)28/h1-3,5-8,12-13H,4,9-11H2,(H,29,30) |
| InChIKey | GBCHXGHEPCCNEI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|