About 1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide
1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide (PubChem CID 165098728) has the molecular formula C20H22Br2N2O2
and a molecular weight of 482.22 g/mol. Its IUPAC name is 1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide.
Molecular Properties
| Compound Name | 1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide |
| PubChem CID | 165098728 |
| Molecular Formula | C20H22Br2N2O2 |
| Molecular Weight | 482.22 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | 1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide |
| SMILES | Br.CC(C(=O)C=[N+]=[N-])c1ccccc1.CC(C(=O)CBr)c1ccccc1 |
| InChI | InChI=1S/C10H11BrO.C10H10N2O.BrH/c1-8(10(12)7-11)9-5-3-2-4-6-9;1-8(10(13)7-12-11)9-5-3-2-4-6-9;/h2-6,8H,7H2,1H3;2-8H,1H3;1H |
| InChIKey | BFZVVSUNXYPGRX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.22 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide?
The IUPAC name of 1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide (CID 165098728) is 1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide.
What is the SMILES notation for 1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide?
The canonical SMILES for 1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide is Br.CC(C(=O)C=[N+]=[N-])c1ccccc1.CC(C(=O)CBr)c1ccccc1.
What is the InChIKey of 1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide?
The InChIKey is BFZVVSUNXYPGRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO.C10H10N2O.BrH/c1-8(10(12)7-11)9-5-3-2-4-6-9;1-8(10(13)7-12-11)9-5-3-2-4-6-9;/h2-6,8H,7H2,1H3;2-8H,1H3;1H.
What are the key properties of 1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide?
1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide has a molecular weight of 482.22 g/mol, XLogP of 4.99, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-phenylbutan-2-one;1-diazo-3-phenylbutan-2-one;hydrobromide is sourced from PubChem (CID 165098728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).