C27H22FN6O3+ — CID 165105038
[[5-[[6-fluoro-5-[4-(2-hydroxyphenyl)phenyl]-1H-benzimidazol-2-yl]oxy]-2-methylphenyl]carbamoylhydrazinylidene]azanium (PubChem CID 165105038) has the molecular formula C27H22FN6O3+ and a molecular weight of 497.51 g/mol. Its IUPAC name is [[5-[[6-fluoro-5-[4-(2-hydroxyphenyl)phenyl]-1H-benzimidazol-2-yl]oxy]-2-methylphenyl]carbamoylhydrazinylidene]azanium.
| Compound Name | [[5-[[6-fluoro-5-[4-(2-hydroxyphenyl)phenyl]-1H-benzimidazol-2-yl]oxy]-2-methylphenyl]carbamoylhydrazinylidene]azanium |
|---|---|
| PubChem CID | 165105038 |
| Molecular Formula | C27H22FN6O3+ |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | [[5-[[6-fluoro-5-[4-(2-hydroxyphenyl)phenyl]-1H-benzimidazol-2-yl]oxy]-2-methylphenyl]carbamoylhydrazinylidene]azanium |
| SMILES | Cc1ccc(Oc2nc3cc(-c4ccc(-c5ccccc5O)cc4)c(F)cc3[nH]2)cc1NC(=O)NN=[NH2+] |
| InChI | InChI=1S/C27H21FN6O3/c1-15-6-11-18(12-22(15)30-26(36)33-34-29)37-27-31-23-13-20(21(28)14-24(23)32-27)17-9-7-16(8-10-17)19-4-2-3-5-25(19)35/h2-14,35H,1H3,(H,31,32)(H3,29,30,33,36)/p+1 |
| InChIKey | YZFLHPDVEZJANT-UHFFFAOYSA-O |
| XLogP | 5.09 |
| TPSA | 137.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|