C10H18N2 — CID 165120354
ethene;N'-methyl-N-(4-methylpenta-1,3-dien-3-yl)methanimidamide (PubChem CID 165120354) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is ethene;N'-methyl-N-(4-methylpenta-1,3-dien-3-yl)methanimidamide.
| Compound Name | ethene;N'-methyl-N-(4-methylpenta-1,3-dien-3-yl)methanimidamide |
|---|---|
| PubChem CID | 165120354 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | ethene;N'-methyl-N-(4-methylpenta-1,3-dien-3-yl)methanimidamide |
| SMILES | C=C.C=CC(N/C=N/C)=C(C)C |
| InChI | InChI=1S/C8H14N2.C2H4/c1-5-8(7(2)3)10-6-9-4;1-2/h5-6H,1H2,2-4H3,(H,9,10);1-2H2 |
| InChIKey | OPIAOTRUFOFNDY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|