C24H46NO6+ — CID 165124048
tripropyl-[3,3,3-tri(butanoyloxy)propyl]azanium (PubChem CID 165124048) has the molecular formula C24H46NO6+ and a molecular weight of 444.63 g/mol. Its IUPAC name is tripropyl-[3,3,3-tri(butanoyloxy)propyl]azanium.
| Compound Name | tripropyl-[3,3,3-tri(butanoyloxy)propyl]azanium |
|---|---|
| PubChem CID | 165124048 |
| Molecular Formula | C24H46NO6+ |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.33 |
| IUPAC Name | tripropyl-[3,3,3-tri(butanoyloxy)propyl]azanium |
| SMILES | CCCC(=O)OC(CC[N+](CCC)(CCC)CCC)(OC(=O)CCC)OC(=O)CCC |
| InChI | InChI=1S/C24H46NO6/c1-7-13-21(26)29-24(30-22(27)14-8-2,31-23(28)15-9-3)16-20-25(17-10-4,18-11-5)19-12-6/h7-20H2,1-6H3/q+1 |
| InChIKey | IJJWMYHAEMDEEC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|