C28H54NO6+ — CID 165124050
tributyl-[4,4,4-tri(butanoyloxy)butyl]azanium (PubChem CID 165124050) has the molecular formula C28H54NO6+ and a molecular weight of 500.74 g/mol. Its IUPAC name is tributyl-[4,4,4-tri(butanoyloxy)butyl]azanium.
| Compound Name | tributyl-[4,4,4-tri(butanoyloxy)butyl]azanium |
|---|---|
| PubChem CID | 165124050 |
| Molecular Formula | C28H54NO6+ |
| Molecular Weight | 500.74 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | tributyl-[4,4,4-tri(butanoyloxy)butyl]azanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC(OC(=O)CCC)(OC(=O)CCC)OC(=O)CCC |
| InChI | InChI=1S/C28H54NO6/c1-7-13-21-29(22-14-8-2,23-15-9-3)24-16-20-28(33-25(30)17-10-4,34-26(31)18-11-5)35-27(32)19-12-6/h7-24H2,1-6H3/q+1 |
| InChIKey | IEHCMBVKIXKJPD-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.74 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|