C21H23F2N6O2Pt- — CID 165126536
2-[4-[[(2-ethyl-6-fluoroimidazo[1,2-a]pyridine-3-carbonyl)amino]methyl]-2-fluoroanilino]ethyl-(C-methoxycarbonimidoyl)azanide;platinum (PubChem CID 165126536) has the molecular formula C21H23F2N6O2Pt- and a molecular weight of 624.53 g/mol. Its IUPAC name is 2-[4-[[(2-ethyl-6-fluoroimidazo[1,2-a]pyridine-3-carbonyl)amino]methyl]-2-fluoroanilino]ethyl-(C-methoxycarbonimidoyl)azanide;platinum.
| Compound Name | 2-[4-[[(2-ethyl-6-fluoroimidazo[1,2-a]pyridine-3-carbonyl)amino]methyl]-2-fluoroanilino]ethyl-(C-methoxycarbonimidoyl)azanide;platinum |
|---|---|
| PubChem CID | 165126536 |
| Molecular Formula | C21H23F2N6O2Pt- |
| Molecular Weight | 624.53 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | 2-[4-[[(2-ethyl-6-fluoroimidazo[1,2-a]pyridine-3-carbonyl)amino]methyl]-2-fluoroanilino]ethyl-(C-methoxycarbonimidoyl)azanide;platinum |
| SMILES | [H]/N=C(/[N-]CCNc1ccc(CNC(=O)c2c(CC)nc3ccc(F)cn23)cc1F)OC.[Pt] |
| InChI | InChI=1S/C21H24F2N6O2.Pt/c1-3-16-19(29-12-14(22)5-7-18(29)28-16)20(30)27-11-13-4-6-17(15(23)10-13)25-8-9-26-21(24)31-2;/h4-7,10,12,25H,3,8-9,11H2,1-2H3,(H3,24,26,27,30);/p-1 |
| InChIKey | WFEBXEGTSVRMDY-UHFFFAOYSA-M |
| XLogP | 3.47 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|