C24H26F4N8OS — CID 165126643
2-cyclopropyl-N-[[3-fluoro-4-[N'-(1,2,3,6-tetrahydropyrazin-5-yl)carbamimidoyl]phenyl]methyl]-6-methylimidazo[1,2-a]pyrimidine-3-carboxamide;trifluoromethanethiol (PubChem CID 165126643) has the molecular formula C24H26F4N8OS and a molecular weight of 550.59 g/mol. Its IUPAC name is 2-cyclopropyl-N-[[3-fluoro-4-[N'-(1,2,3,6-tetrahydropyrazin-5-yl)carbamimidoyl]phenyl]methyl]-6-methylimidazo[1,2-a]pyrimidine-3-carboxamide;trifluoromethanethiol.
| Compound Name | 2-cyclopropyl-N-[[3-fluoro-4-[N'-(1,2,3,6-tetrahydropyrazin-5-yl)carbamimidoyl]phenyl]methyl]-6-methylimidazo[1,2-a]pyrimidine-3-carboxamide;trifluoromethanethiol |
|---|---|
| PubChem CID | 165126643 |
| Molecular Formula | C24H26F4N8OS |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 2-cyclopropyl-N-[[3-fluoro-4-[N'-(1,2,3,6-tetrahydropyrazin-5-yl)carbamimidoyl]phenyl]methyl]-6-methylimidazo[1,2-a]pyrimidine-3-carboxamide;trifluoromethanethiol |
| SMILES | Cc1cnc2nc(C3CC3)c(C(=O)NCc3ccc(/C(N)=N/C4=NCCNC4)c(F)c3)n2c1.FC(F)(F)S |
| InChI | InChI=1S/C23H25FN8O.CHF3S/c1-13-9-29-23-31-19(15-3-4-15)20(32(23)12-13)22(33)28-10-14-2-5-16(17(24)8-14)21(25)30-18-11-26-6-7-27-18;2-1(3,4)5/h2,5,8-9,12,15,26H,3-4,6-7,10-11H2,1H3,(H,28,33)(H2,25,27,30);5H |
| InChIKey | OIRJJHOGQZPKQU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|