C24H29N7O — CID 165126726
2-ethyl-N-[[3-(1,2,4,5,6,7-hexahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)phenyl]methyl]-6-methylimidazo[1,2-a]pyrimidine-3-carboxamide (PubChem CID 165126726) has the molecular formula C24H29N7O and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-ethyl-N-[[3-(1,2,4,5,6,7-hexahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)phenyl]methyl]-6-methylimidazo[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | 2-ethyl-N-[[3-(1,2,4,5,6,7-hexahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)phenyl]methyl]-6-methylimidazo[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 165126726 |
| Molecular Formula | C24H29N7O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 2-ethyl-N-[[3-(1,2,4,5,6,7-hexahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)phenyl]methyl]-6-methylimidazo[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CCc1nc2ncc(C)cn2c1C(=O)NCc1cccc(CC2C=C3CNCCN3N2)c1 |
| InChI | InChI=1S/C24H29N7O/c1-3-21-22(30-15-16(2)12-27-24(30)28-21)23(32)26-13-18-6-4-5-17(9-18)10-19-11-20-14-25-7-8-31(20)29-19/h4-6,9,11-12,15,19,25,29H,3,7-8,10,13-14H2,1-2H3,(H,26,32) |
| InChIKey | YYUCXRYLUHKUKZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |