C24H27F4N9OS — CID 165126729
2-cyclopropyl-N-[[5-fluoro-6-(7-fluoro-3-methyl-2,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)-3-pyridinyl]methyl]-6-methylimidazo[1,2-a]pyrimidine-3-carboxamide;difluoromethanethiol (PubChem CID 165126729) has the molecular formula C24H27F4N9OS and a molecular weight of 565.60 g/mol. Its IUPAC name is 2-cyclopropyl-N-[[5-fluoro-6-(7-fluoro-3-methyl-2,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)-3-pyridinyl]methyl]-6-methylimidazo[1,2-a]pyrimidine-3-carboxamide;difluoromethanethiol.
| Compound Name | 2-cyclopropyl-N-[[5-fluoro-6-(7-fluoro-3-methyl-2,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)-3-pyridinyl]methyl]-6-methylimidazo[1,2-a]pyrimidine-3-carboxamide;difluoromethanethiol |
|---|---|
| PubChem CID | 165126729 |
| Molecular Formula | C24H27F4N9OS |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 2-cyclopropyl-N-[[5-fluoro-6-(7-fluoro-3-methyl-2,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)-3-pyridinyl]methyl]-6-methylimidazo[1,2-a]pyrimidine-3-carboxamide;difluoromethanethiol |
| SMILES | Cc1cnc2nc(C3CC3)c(C(=O)NCc3cnc(C4N=C5CN(F)CCN5N4C)c(F)c3)n2c1.FC(F)S |
| InChI | InChI=1S/C23H25F2N9O.CH2F2S/c1-13-8-28-23-30-18(15-3-4-15)20(33(23)11-13)22(35)27-10-14-7-16(24)19(26-9-14)21-29-17-12-32(25)5-6-34(17)31(21)2;2-1(3)4/h7-9,11,15,21H,3-6,10,12H2,1-2H3,(H,27,35);1,4H |
| InChIKey | HAMLFSNRHHOVKP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 94.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|