C24H54N10 — CID 165128044
3-[2-[bis[2-[(3-amino-3-propan-2-yliminopropyl)amino]ethyl]amino]ethylamino]-N'-propan-2-ylpropanimidamide (PubChem CID 165128044) has the molecular formula C24H54N10 and a molecular weight of 482.77 g/mol. Its IUPAC name is 3-[2-[bis[2-[(3-amino-3-propan-2-yliminopropyl)amino]ethyl]amino]ethylamino]-N'-propan-2-ylpropanimidamide.
| Compound Name | 3-[2-[bis[2-[(3-amino-3-propan-2-yliminopropyl)amino]ethyl]amino]ethylamino]-N'-propan-2-ylpropanimidamide |
|---|---|
| PubChem CID | 165128044 |
| Molecular Formula | C24H54N10 |
| Molecular Weight | 482.77 g/mol |
| Exact Mass | 482.45 |
| IUPAC Name | 3-[2-[bis[2-[(3-amino-3-propan-2-yliminopropyl)amino]ethyl]amino]ethylamino]-N'-propan-2-ylpropanimidamide |
| SMILES | CC(C)/N=C(\N)CCNCCN(CCNCC/C(N)=N/C(C)C)CCNCC/C(N)=N/C(C)C |
| InChI | InChI=1S/C24H54N10/c1-19(2)31-22(25)7-10-28-13-16-34(17-14-29-11-8-23(26)32-20(3)4)18-15-30-12-9-24(27)33-21(5)6/h19-21,28-30H,7-18H2,1-6H3,(H2,25,31)(H2,26,32)(H2,27,33) |
| InChIKey | ZONBBVYHXZMZOG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 154.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.77 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|