C20H14FN5OS — CID 165129066
3-[[5-(3-fluorophenyl)pyrimidin-2-yl]amino]-2-(1,3-thiazol-2-yl)benzamide (PubChem CID 165129066) has the molecular formula C20H14FN5OS and a molecular weight of 391.43 g/mol. Its IUPAC name is 3-[[5-(3-fluorophenyl)pyrimidin-2-yl]amino]-2-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-[[5-(3-fluorophenyl)pyrimidin-2-yl]amino]-2-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 165129066 |
| Molecular Formula | C20H14FN5OS |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 3-[[5-(3-fluorophenyl)pyrimidin-2-yl]amino]-2-(1,3-thiazol-2-yl)benzamide |
| SMILES | NC(=O)c1cccc(Nc2ncc(-c3cccc(F)c3)cn2)c1-c1nccs1 |
| InChI | InChI=1S/C20H14FN5OS/c21-14-4-1-3-12(9-14)13-10-24-20(25-11-13)26-16-6-2-5-15(18(22)27)17(16)19-23-7-8-28-19/h1-11H,(H2,22,27)(H,24,25,26) |
| InChIKey | LXDWIGKOMRHEIP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |