C14H4Cl2F4N2O2 — CID 165129388
5,6-dichloro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-1H-benzimidazole-4,7-dione (PubChem CID 165129388) has the molecular formula C14H4Cl2F4N2O2 and a molecular weight of 379.10 g/mol. Its IUPAC name is 5,6-dichloro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-1H-benzimidazole-4,7-dione.
| Compound Name | 5,6-dichloro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-1H-benzimidazole-4,7-dione |
|---|---|
| PubChem CID | 165129388 |
| Molecular Formula | C14H4Cl2F4N2O2 |
| Molecular Weight | 379.10 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | 5,6-dichloro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-1H-benzimidazole-4,7-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)c2[nH]c(-c3ccc(C(F)(F)F)c(F)c3)nc21 |
| InChI | InChI=1S/C14H4Cl2F4N2O2/c15-7-8(16)12(24)10-9(11(7)23)21-13(22-10)4-1-2-5(6(17)3-4)14(18,19)20/h1-3H,(H,21,22) |
| InChIKey | GNXYXLVBVJDSLR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.10 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|