C33H41FN4 — CID 165134303
6-[(2E,4E,6E)-3-fluoronona-2,4,6-trien-5-yl]-3-heptan-2-yl-N-[2-(1H-indol-3-yl)ethyl]imidazo[1,2-a]pyridin-8-amine (PubChem CID 165134303) has the molecular formula C33H41FN4 and a molecular weight of 512.72 g/mol. Its IUPAC name is 6-[(2E,4E,6E)-3-fluoronona-2,4,6-trien-5-yl]-3-heptan-2-yl-N-[2-(1H-indol-3-yl)ethyl]imidazo[1,2-a]pyridin-8-amine.
| Compound Name | 6-[(2E,4E,6E)-3-fluoronona-2,4,6-trien-5-yl]-3-heptan-2-yl-N-[2-(1H-indol-3-yl)ethyl]imidazo[1,2-a]pyridin-8-amine |
|---|---|
| PubChem CID | 165134303 |
| Molecular Formula | C33H41FN4 |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | 6-[(2E,4E,6E)-3-fluoronona-2,4,6-trien-5-yl]-3-heptan-2-yl-N-[2-(1H-indol-3-yl)ethyl]imidazo[1,2-a]pyridin-8-amine |
| SMILES | C/C=C(F)\C=C(/C=C/CC)c1cc(NCCc2c[nH]c3ccccc23)c2ncc(C(C)CCCCC)n2c1 |
| InChI | InChI=1S/C33H41FN4/c1-5-8-10-13-24(4)32-22-37-33-31(35-18-17-26-21-36-30-16-12-11-15-29(26)30)20-27(23-38(32)33)25(14-9-6-2)19-28(34)7-3/h7,9,11-12,14-16,19-24,35-36H,5-6,8,10,13,17-18H2,1-4H3/b14-9+,25-19+,28-7+ |
| InChIKey | RGBWTHDUFNIHMM-LHUVEWCLSA-N |
| XLogP | 9.38 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|