C20H25N7 — CID 165134863
4-[6-(4-aminophenyl)-1,4-dihydro-1,2,4,5-tetrazin-3-yl]-2-(piperidin-1-ylmethyl)aniline (PubChem CID 165134863) has the molecular formula C20H25N7 and a molecular weight of 363.47 g/mol. Its IUPAC name is 4-[6-(4-aminophenyl)-1,4-dihydro-1,2,4,5-tetrazin-3-yl]-2-(piperidin-1-ylmethyl)aniline.
| Compound Name | 4-[6-(4-aminophenyl)-1,4-dihydro-1,2,4,5-tetrazin-3-yl]-2-(piperidin-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 165134863 |
| Molecular Formula | C20H25N7 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 4-[6-(4-aminophenyl)-1,4-dihydro-1,2,4,5-tetrazin-3-yl]-2-(piperidin-1-ylmethyl)aniline |
| SMILES | Nc1ccc(C2=NNC(c3ccc(N)c(CN4CCCCC4)c3)=NN2)cc1 |
| InChI | InChI=1S/C20H25N7/c21-17-7-4-14(5-8-17)19-23-25-20(26-24-19)15-6-9-18(22)16(12-15)13-27-10-2-1-3-11-27/h4-9,12H,1-3,10-11,13,21-22H2,(H,23,24)(H,25,26) |
| InChIKey | ZFYKWHXGWKUICJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|