C15H18N2O2S — CID 165142904
6-[(Z)-2-(ethenyliminomethyl)but-2-enyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid (PubChem CID 165142904) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 6-[(Z)-2-(ethenyliminomethyl)but-2-enyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid.
| Compound Name | 6-[(Z)-2-(ethenyliminomethyl)but-2-enyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 165142904 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 6-[(Z)-2-(ethenyliminomethyl)but-2-enyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid |
| SMILES | C=C/N=C/C(=C\C)CN1CCc2c(C(=O)O)csc2C1 |
| InChI | InChI=1S/C15H18N2O2S/c1-3-11(7-16-4-2)8-17-6-5-12-13(15(18)19)10-20-14(12)9-17/h3-4,7,10H,2,5-6,8-9H2,1H3,(H,18,19)/b11-3+,16-7+ |
| InChIKey | WOFRRJVJXYOZQK-IZQHMAPUSA-N |
| XLogP | 2.96 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|