C12H12ClF3N2O3 — CID 165144583
N-(2-chloro-5-nitrophenyl)-4,4,4-trifluoro-N,3-dimethylbutanamide (PubChem CID 165144583) has the molecular formula C12H12ClF3N2O3 and a molecular weight of 324.69 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-4,4,4-trifluoro-N,3-dimethylbutanamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-4,4,4-trifluoro-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 165144583 |
| Molecular Formula | C12H12ClF3N2O3 |
| Molecular Weight | 324.69 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-4,4,4-trifluoro-N,3-dimethylbutanamide |
| SMILES | CC(CC(=O)N(C)c1cc([N+](=O)[O-])ccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C12H12ClF3N2O3/c1-7(12(14,15)16)5-11(19)17(2)10-6-8(18(20)21)3-4-9(10)13/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | VVNGMLZOPCAPRJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.69 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|