C17H9Cl3F4N2O3 — CID 165144653
trans-(1R,3R)-2,2-dichloro-N-(4-chloro-3-nitrophenyl)-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 165144653) has the molecular formula C17H9Cl3F4N2O3 and a molecular weight of 471.62 g/mol. Its IUPAC name is trans-(1R,3R)-2,2-dichloro-N-(4-chloro-3-nitrophenyl)-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-2,2-dichloro-N-(4-chloro-3-nitrophenyl)-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 165144653 |
| Molecular Formula | C17H9Cl3F4N2O3 |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 469.96 |
| IUPAC Name | trans-(1R,3R)-2,2-dichloro-N-(4-chloro-3-nitrophenyl)-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c([N+](=O)[O-])c1)[C@H]1[C@H](c2ccc(F)c(C(F)(F)F)c2)C1(Cl)Cl |
| InChI | InChI=1S/C17H9Cl3F4N2O3/c18-10-3-2-8(6-12(10)26(28)29)25-15(27)14-13(16(14,19)20)7-1-4-11(21)9(5-7)17(22,23)24/h1-6,13-14H,(H,25,27)/t13-,14+/m0/s1 |
| InChIKey | PPJGEXCWJWNMKY-UONOGXRCSA-N |
| XLogP | 5.93 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|