C31H30N2O2S — CID 165145801
ethyl (3S,4R)-4-[4-(benzhydrylideneamino)thiophen-3-yl]-1-benzylpyrrolidine-3-carboxylate (PubChem CID 165145801) has the molecular formula C31H30N2O2S and a molecular weight of 494.66 g/mol. Its IUPAC name is ethyl (3S,4R)-4-[4-(benzhydrylideneamino)thiophen-3-yl]-1-benzylpyrrolidine-3-carboxylate.
| Compound Name | ethyl (3S,4R)-4-[4-(benzhydrylideneamino)thiophen-3-yl]-1-benzylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 165145801 |
| Molecular Formula | C31H30N2O2S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | ethyl (3S,4R)-4-[4-(benzhydrylideneamino)thiophen-3-yl]-1-benzylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CN(Cc2ccccc2)C[C@H]1c1cscc1N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30N2O2S/c1-2-35-31(34)27-20-33(18-23-12-6-3-7-13-23)19-26(27)28-21-36-22-29(28)32-30(24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17,21-22,26-27H,2,18-20H2,1H3/t26-,27-/m1/s1 |
| InChIKey | WISXEXUNPBKHAX-KAYWLYCHSA-N |
| XLogP | 6.70 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|