C25H26N6O — CID 165146690
(E)-4-(dimethylamino)-N-[3-[8-(2-methylanilino)imidazo[1,5-a]pyrazin-5-yl]phenyl]but-2-enamide (PubChem CID 165146690) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-[3-[8-(2-methylanilino)imidazo[1,5-a]pyrazin-5-yl]phenyl]but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-[3-[8-(2-methylanilino)imidazo[1,5-a]pyrazin-5-yl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 165146690 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (E)-4-(dimethylamino)-N-[3-[8-(2-methylanilino)imidazo[1,5-a]pyrazin-5-yl]phenyl]but-2-enamide |
| SMILES | Cc1ccccc1Nc1ncc(-c2cccc(NC(=O)/C=C/CN(C)C)c2)n2cncc12 |
| InChI | InChI=1S/C25H26N6O/c1-18-8-4-5-11-21(18)29-25-23-15-26-17-31(23)22(16-27-25)19-9-6-10-20(14-19)28-24(32)12-7-13-30(2)3/h4-12,14-17H,13H2,1-3H3,(H,27,29)(H,28,32)/b12-7+ |
| InChIKey | UNPFUTCUNHRXHW-KPKJPENVSA-N |
| XLogP | 4.50 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|