C30H35N7O2 — CID 165146639
(E)-N-[3-[8-(2-methylanilino)imidazo[1,5-a]pyrazin-5-yl]oxyphenyl]-4-(4-propan-2-ylpiperazin-1-yl)but-2-enamide (PubChem CID 165146639) has the molecular formula C30H35N7O2 and a molecular weight of 525.66 g/mol. Its IUPAC name is (E)-N-[3-[8-(2-methylanilino)imidazo[1,5-a]pyrazin-5-yl]oxyphenyl]-4-(4-propan-2-ylpiperazin-1-yl)but-2-enamide.
| Compound Name | (E)-N-[3-[8-(2-methylanilino)imidazo[1,5-a]pyrazin-5-yl]oxyphenyl]-4-(4-propan-2-ylpiperazin-1-yl)but-2-enamide |
|---|---|
| PubChem CID | 165146639 |
| Molecular Formula | C30H35N7O2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | (E)-N-[3-[8-(2-methylanilino)imidazo[1,5-a]pyrazin-5-yl]oxyphenyl]-4-(4-propan-2-ylpiperazin-1-yl)but-2-enamide |
| SMILES | Cc1ccccc1Nc1ncc(Oc2cccc(NC(=O)/C=C/CN3CCN(C(C)C)CC3)c2)n2cncc12 |
| InChI | InChI=1S/C30H35N7O2/c1-22(2)36-16-14-35(15-17-36)13-7-12-28(38)33-24-9-6-10-25(18-24)39-29-20-32-30(27-19-31-21-37(27)29)34-26-11-5-4-8-23(26)3/h4-12,18-22H,13-17H2,1-3H3,(H,32,34)(H,33,38)/b12-7+ |
| InChIKey | HYUORISRTIURGZ-KPKJPENVSA-N |
| XLogP | 5.09 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|