C24H28N8O4 — CID 135203774
[3-[[(E)-4-(4-hydroxypiperidin-1-yl)but-2-enoyl]amino]phenyl] N-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]carbamate (PubChem CID 135203774) has the molecular formula C24H28N8O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is [3-[[(E)-4-(4-hydroxypiperidin-1-yl)but-2-enoyl]amino]phenyl] N-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]carbamate.
| Compound Name | [3-[[(E)-4-(4-hydroxypiperidin-1-yl)but-2-enoyl]amino]phenyl] N-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 135203774 |
| Molecular Formula | C24H28N8O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | [3-[[(E)-4-(4-hydroxypiperidin-1-yl)but-2-enoyl]amino]phenyl] N-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]carbamate |
| SMILES | Cn1cc(Nc2nccc(NC(=O)Oc3cccc(NC(=O)/C=C/CN4CCC(O)CC4)c3)n2)cn1 |
| InChI | InChI=1S/C24H28N8O4/c1-31-16-18(15-26-31)28-23-25-10-7-21(29-23)30-24(35)36-20-5-2-4-17(14-20)27-22(34)6-3-11-32-12-8-19(33)9-13-32/h2-7,10,14-16,19,33H,8-9,11-13H2,1H3,(H,27,34)(H2,25,28,29,30,35)/b6-3+ |
| InChIKey | FBTNNLWXSOUJNP-ZZXKWVIFSA-N |
| XLogP | 2.52 |
| TPSA | 146.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|