C58H46F3N5O3S+2 — CID 165148551
[2-[4-[2-[3,5-bis[2-[4-(3-phenylimidazol-1-ium-1-yl)phenyl]ethyl]phenyl]phenyl]phenyl]-4-pyridinyl] trifluoromethanesulfonate (PubChem CID 165148551) has the molecular formula C58H46F3N5O3S+2 and a molecular weight of 950.10 g/mol. Its IUPAC name is [2-[4-[2-[3,5-bis[2-[4-(3-phenylimidazol-1-ium-1-yl)phenyl]ethyl]phenyl]phenyl]phenyl]-4-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [2-[4-[2-[3,5-bis[2-[4-(3-phenylimidazol-1-ium-1-yl)phenyl]ethyl]phenyl]phenyl]phenyl]-4-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 165148551 |
| Molecular Formula | C58H46F3N5O3S+2 |
| Molecular Weight | 950.10 g/mol |
| Exact Mass | 949.33 |
| IUPAC Name | [2-[4-[2-[3,5-bis[2-[4-(3-phenylimidazol-1-ium-1-yl)phenyl]ethyl]phenyl]phenyl]phenyl]-4-pyridinyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccnc(-c2ccc(-c3ccccc3-c3cc(CCc4ccc(-[n+]5ccn(-c6ccccc6)c5)cc4)cc(CCc4ccc(-[n+]5ccn(-c6ccccc6)c5)cc4)c3)cc2)c1)C(F)(F)F |
| InChI | InChI=1S/C58H46F3N5O3S/c59-58(60,61)70(67,68)69-54-31-32-62-57(40-54)48-25-23-47(24-26-48)55-13-7-8-14-56(55)49-38-45(17-15-43-19-27-52(28-20-43)65-35-33-63(41-65)50-9-3-1-4-10-50)37-46(39-49)18-16-44-21-29-53(30-22-44)66-36-34-64(42-66)51-11-5-2-6-12-51/h1-14,19-42H,15-18H2/q+2 |
| InChIKey | YCXKWIJMVUJUSK-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.10 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|